Products 1213767-07-7
CAS 1213767-07-7 appears in our catalog under these names: Methyl 2–Cyano–4–Methylbenzoate, Methyl 2-cyano-4-methylbenzoate, Methyl 2-cyano-4-methylbenzoate 95%, Methyl 2-cyano-4-methylbenzoate, 95%, 95%, METHYL 2-CYANO-4-METHYLBENZOATE, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
Methyl 2-cyano-4-methylbenzoate (CAS 1213767-07-7) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: methyl 2-cyano-4-methylbenzoate. InChIKey: RLGXGTZNMCDVFB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | methyl 2-cyano-4-methylbenzoate |
| InChIKey | RLGXGTZNMCDVFB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OC)C#N |
Computed by PubChem (NCBI)