CAS 1213914-40-9 is the registry number for Methyl (2r)-2-amino-2-(4-bromophenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (2R)-2-amino-2-(4-bromophenyl)acetate (CAS 1213914-40-9) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-bromophenyl)acetate. InChIKey: YERRTOUSFSZICJ-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-bromophenyl)acetate |
| InChIKey | YERRTOUSFSZICJ-MRVPVSSYSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)Br)N |
Computed by PubChem (NCBI)