CAS 121394-38-5 appears in our catalog under these names: 6-Bromo-2,3-dimethylimidazo(1,2-a)pyridine, 95+%, 6-Bromo-2,3-dimethylimidazo(1,2-a)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.
6-bromo-2,3-dimethylimidazo[1,2-a]pyridine (CAS 121394-38-5) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-2,3-dimethylimidazo[1,2-a]pyridine. InChIKey: AXJKPHYIERDRBX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-2,3-dimethylimidazo[1,2-a]pyridine |
| InChIKey | AXJKPHYIERDRBX-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(C=CC2=N1)Br)C |
Computed by PubChem (NCBI)