Products 1213961-88-6

CAS 1213961-88-6 is the registry number for (R)-3-Methyl-2-(pyrrolidin-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-methyl-2-[(2R)-pyrrolidin-2-yl]benzoic acid (CAS 1213961-88-6) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 3-methyl-2-[(2R)-pyrrolidin-2-yl]benzoic acid. InChIKey: GRWIZRNKXRLBDZ-SNVBAGLBSA-N.

Identity
Molecular formulaC12H15NO2
Molecular weight205.25 g/mol
IUPAC name3-methyl-2-[(2R)-pyrrolidin-2-yl]benzoic acid
InChIKeyGRWIZRNKXRLBDZ-SNVBAGLBSA-N
SMILESCC1=C(C(=CC=C1)C(=O)O)[C@H]2CCCN2

Computed by PubChem (NCBI)