CAS 1214028-87-1 appears in our catalog under these names: 2-Methyl-1,3,7-triazaspiro[4.5]dec-2-en-4-one hydrochloride, 97%, 97%, 2-Methyl-1,3,7-triazaspiro[4.5]dec-1-en-4-one hydrochloride, 97%, 2-Methyl-1,3,7-triazaspiro[4.5]dec-2-en-4-one hydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one;hydrochloride (CAS 1214028-87-1) is a chemical compound with the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. IUPAC name: 2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one;hydrochloride. InChIKey: KZPDXOKBRNNZFK-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one;hydrochloride |
| InChIKey | KZPDXOKBRNNZFK-UHFFFAOYSA-N |
| SMILES | CC1=NC2(CCCNC2)C(=O)N1.Cl |
Computed by PubChem (NCBI)