CAS 1269225-18-4 is the registry number for [(5-Cyclopentyl-1,2,4-oxadiazol-3-yl)methyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(5-cyclopentyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride (CAS 1269225-18-4) is a chemical compound with the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. IUPAC name: (5-cyclopentyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride. InChIKey: BKUNJLWWGVWHOX-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | (5-cyclopentyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
| InChIKey | BKUNJLWWGVWHOX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC(=NO2)CN.Cl |
Computed by PubChem (NCBI)