CAS 1426291-14-6 is the registry number for 5-Azetidin-3-yl-3-isopropyl-1,2,4-oxadiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-(azetidin-3-yl)-3-propan-2-yl-1,2,4-oxadiazole;hydrochloride (CAS 1426291-14-6) is a chemical compound with the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. IUPAC name: 5-(azetidin-3-yl)-3-propan-2-yl-1,2,4-oxadiazole;hydrochloride. InChIKey: RGVXUGFNCOJOHY-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 5-(azetidin-3-yl)-3-propan-2-yl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | RGVXUGFNCOJOHY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC(=N1)C2CNC2.Cl |
Computed by PubChem (NCBI)