Products 1604396-49-7
CAS 1604396-49-7 appears in our catalog under these names: (S)-3-methyl-5-(piperidin-2-yl)-1,2,4-oxadiazole hydrochloride, 95%, (S)-3-Methyl-5-(piperidin-2-yl)-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, on request.
3-methyl-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride (CAS 1604396-49-7) is a chemical compound with the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. IUPAC name: 3-methyl-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride. InChIKey: VNKGWZCRQRWCCJ-FJXQXJEOSA-N.
| Molecular formula | C8H14ClN3O |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 3-methyl-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride |
| InChIKey | VNKGWZCRQRWCCJ-FJXQXJEOSA-N |
| SMILES | CC1=NOC(=N1)[C@@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)