Products 1214091-36-7

CAS 1214091-36-7 is the registry number for N-Cyclopentyl DL-Z-Phenylalaninamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 1214091-36-7) is a chemical compound with the molecular formula C22H26N2O3 and a molecular weight of 366.5 g/mol. IUPAC name: benzyl N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: UPAUTEODCBEWJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H26N2O3
Molecular weight366.5 g/mol
IUPAC namebenzyl N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]carbamate
InChIKeyUPAUTEODCBEWJZ-UHFFFAOYSA-N
SMILESC1CCC(C1)NC(=O)C(CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)