Products 139239-49-9
CAS 139239-49-9 is the registry number for 9-Acetyl Apoquinidine Methyl Ether. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
[(S)-[(2R,5Z)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate (CAS 139239-49-9) is a chemical compound with the molecular formula C22H26N2O3 and a molecular weight of 366.5 g/mol. IUPAC name: [(S)-[(2R,5Z)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate. InChIKey: UVUZUZKZOWNTJI-BTCOUWEZSA-N.
| Molecular formula | C22H26N2O3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | [(S)-[(2R,5Z)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate |
| InChIKey | UVUZUZKZOWNTJI-BTCOUWEZSA-N |
| SMILES | C/C=C/1\CN2CCC1C[C@@H]2[C@H](C3=C4C=C(C=CC4=NC=C3)OC)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
9-Acetyl Apoquinidine Methyl Ether