Products 1252655-88-1
CAS 1252655-88-1 is the registry number for 4-([4-(2-tert-Butylphenyl)piperazin-1-yl]carbonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]benzoic acid (CAS 1252655-88-1) is a chemical compound with the molecular formula C22H26N2O3 and a molecular weight of 366.5 g/mol. IUPAC name: 4-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]benzoic acid. InChIKey: PTAMSLYHEHTWRZ-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 4-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]benzoic acid |
| InChIKey | PTAMSLYHEHTWRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1N2CCN(CC2)C(=O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)