Products 2365419-69-6
CAS 2365419-69-6 is the registry number for tert-Butyl 4-(4-benzoylphenyl)piperazine-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Tert-butyl 4-(4-benzoylphenyl)piperazine-1-carboxylate (CAS 2365419-69-6) is a chemical compound with the molecular formula C22H26N2O3 and a molecular weight of 366.5 g/mol. IUPAC name: tert-butyl 4-(4-benzoylphenyl)piperazine-1-carboxylate. InChIKey: IXQULWVDBZDUQG-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | tert-butyl 4-(4-benzoylphenyl)piperazine-1-carboxylate |
| InChIKey | IXQULWVDBZDUQG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)