Products 1214338-07-4
CAS 1214338-07-4 is the registry number for 1-(2-(Difluoromethoxy)-5-fluorophenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[2-(difluoromethoxy)-5-fluorophenyl]ethanone (CAS 1214338-07-4) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 1-[2-(difluoromethoxy)-5-fluorophenyl]ethanone. InChIKey: YCGBQBLOOYNGKN-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 1-[2-(difluoromethoxy)-5-fluorophenyl]ethanone |
| InChIKey | YCGBQBLOOYNGKN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)F)OC(F)F |
Computed by PubChem (NCBI)