CAS 1214340-18-7 is the registry number for 3-Chloro-4-methoxybenzotrifluoride, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
2-chloro-1-methoxy-4-(trifluoromethyl)benzene (CAS 1214340-18-7) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 2-chloro-1-methoxy-4-(trifluoromethyl)benzene. InChIKey: VVRXOIBFPBBYRU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 2-chloro-1-methoxy-4-(trifluoromethyl)benzene |
| InChIKey | VVRXOIBFPBBYRU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)