CAS 1214349-54-8 appears in our catalog under these names: [5-bromo-2-(trifluoromethyl)phenyl]methanol, 97%, 5-Bromo-2-(trifluoromethyl)benzyl alcohol, [5-bromo-2-(trifluoromethyl)phenyl]methanol. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 0,5g, 100mg.
[5-bromo-2-(trifluoromethyl)phenyl]methanol (CAS 1214349-54-8) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: [5-bromo-2-(trifluoromethyl)phenyl]methanol. InChIKey: FCEJEQQBRZHCJZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | [5-bromo-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | FCEJEQQBRZHCJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CO)C(F)(F)F |
Computed by PubChem (NCBI)