Products 1214370-50-9

CAS 1214370-50-9 is the registry number for 2-Amino-5-(4-fluorophenyl)isonicotinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-amino-5-(4-fluorophenyl)pyridine-4-carboxylic acid (CAS 1214370-50-9) is a chemical compound with the molecular formula C12H9FN2O2 and a molecular weight of 232.21 g/mol. IUPAC name: 2-amino-5-(4-fluorophenyl)pyridine-4-carboxylic acid. InChIKey: TZHTVBYTSYUBLB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9FN2O2
Molecular weight232.21 g/mol
IUPAC name2-amino-5-(4-fluorophenyl)pyridine-4-carboxylic acid
InChIKeyTZHTVBYTSYUBLB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CN=C(C=C2C(=O)O)N)F

Computed by PubChem (NCBI)