CAS 1623144-45-5 is the registry number for 5'-Fluoro-2'-methoxy-[3,4'-bipyridine]-6-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5-fluoro-2-methoxy-4-pyridinyl)pyridine-2-carbaldehyde (CAS 1623144-45-5) is a chemical compound with the molecular formula C12H9FN2O2 and a molecular weight of 232.21 g/mol. IUPAC name: 5-(5-fluoro-2-methoxy-4-pyridinyl)pyridine-2-carbaldehyde. InChIKey: WNLOELXKLOGWRE-UHFFFAOYSA-N.
| Molecular formula | C12H9FN2O2 |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | 5-(5-fluoro-2-methoxy-4-pyridinyl)pyridine-2-carbaldehyde |
| InChIKey | WNLOELXKLOGWRE-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)C2=CN=C(C=C2)C=O)F |
Computed by PubChem (NCBI)