CAS 28898-02-4 appears in our catalog under these names: 2-Fluoro-N-(2-nitrophenyl)aniline 95%, 2-Fluoro-N-(2-nitrophenyl)aniline, 95%, 95%, 2-Fluoro-N-(2-nitrophenyl)aniline, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
N-(2-fluorophenyl)-2-nitroaniline (CAS 28898-02-4) is a chemical compound with the molecular formula C12H9FN2O2 and a molecular weight of 232.21 g/mol. IUPAC name: N-(2-fluorophenyl)-2-nitroaniline. InChIKey: AXWDMVVFIGPIKT-UHFFFAOYSA-N.
| Molecular formula | C12H9FN2O2 |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | N-(2-fluorophenyl)-2-nitroaniline |
| InChIKey | AXWDMVVFIGPIKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=CC=CC=C2F)[N+](=O)[O-] |
Computed by PubChem (NCBI)