CAS 1214384-02-7 is the registry number for (2-Fluoro-6-nitrophenyl)methanamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-fluoro-6-nitrophenyl)methanamine;hydrochloride (CAS 1214384-02-7) is a chemical compound with the molecular formula C7H8ClFN2O2 and a molecular weight of 206.60 g/mol. IUPAC name: (2-fluoro-6-nitrophenyl)methanamine;hydrochloride. InChIKey: PQGJONJWJMTGRY-UHFFFAOYSA-N.
| Molecular formula | C7H8ClFN2O2 |
|---|---|
| Molecular weight | 206.60 g/mol |
| IUPAC name | (2-fluoro-6-nitrophenyl)methanamine;hydrochloride |
| InChIKey | PQGJONJWJMTGRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)