CAS 69196-09-4 appears in our catalog under these names: 5-Fluoro-2-hydrazino-benzoic acid hydrochloride, 95%, 5-Fluoro-2-hydrazinylbenzoic acid hydrochloride, 97%, 5-Fluoro-2-hydrazinylbenzoic acid hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
5-fluoro-2-hydrazinylbenzoic acid;hydrochloride (CAS 69196-09-4) is a chemical compound with the molecular formula C7H8ClFN2O2 and a molecular weight of 206.60 g/mol. IUPAC name: 5-fluoro-2-hydrazinylbenzoic acid;hydrochloride. InChIKey: IGGNDRGLNNGPOG-UHFFFAOYSA-N.
| Molecular formula | C7H8ClFN2O2 |
|---|---|
| Molecular weight | 206.60 g/mol |
| IUPAC name | 5-fluoro-2-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | IGGNDRGLNNGPOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)NN.Cl |
Computed by PubChem (NCBI)