Products 1864064-13-0

CAS 1864064-13-0 is the registry number for 2-Fluoro-3-hydrazinylbenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-fluoro-3-hydrazinylbenzoic acid;hydrochloride (CAS 1864064-13-0) is a chemical compound with the molecular formula C7H8ClFN2O2 and a molecular weight of 206.60 g/mol. IUPAC name: 2-fluoro-3-hydrazinylbenzoic acid;hydrochloride. InChIKey: LOCNJWAWUHYLDY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClFN2O2
Molecular weight206.60 g/mol
IUPAC name2-fluoro-3-hydrazinylbenzoic acid;hydrochloride
InChIKeyLOCNJWAWUHYLDY-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)NN)F)C(=O)O.Cl

Computed by PubChem (NCBI)