CAS 199486-37-8 appears in our catalog under these names: (3-Fluoro-4-nitrophenyl)methanamine hydrochloride, 95%, (3-Fluoro-4-nitrophenyl)methanamine Hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
(3-fluoro-4-nitrophenyl)methanamine;hydrochloride (CAS 199486-37-8) is a chemical compound with the molecular formula C7H8ClFN2O2 and a molecular weight of 206.60 g/mol. IUPAC name: (3-fluoro-4-nitrophenyl)methanamine;hydrochloride. InChIKey: QJGLMXSWLJVCIT-UHFFFAOYSA-N.
| Molecular formula | C7H8ClFN2O2 |
|---|---|
| Molecular weight | 206.60 g/mol |
| IUPAC name | (3-fluoro-4-nitrophenyl)methanamine;hydrochloride |
| InChIKey | QJGLMXSWLJVCIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)F)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)