Products 1214384-28-7

CAS 1214384-28-7 is the registry number for 2,5-Di(pyridin-4-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,5-dipyridin-4-ylbenzoic acid (CAS 1214384-28-7) is a chemical compound with the molecular formula C17H12N2O2 and a molecular weight of 276.29 g/mol. IUPAC name: 2,5-dipyridin-4-ylbenzoic acid. InChIKey: OPFFYSOSKYXOTF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12N2O2
Molecular weight276.29 g/mol
IUPAC name2,5-dipyridin-4-ylbenzoic acid
InChIKeyOPFFYSOSKYXOTF-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC=NC=C2)C(=O)O)C3=CC=NC=C3

Computed by PubChem (NCBI)