Products 2034136-90-6
CAS 2034136-90-6 is the registry number for 8,10-Dimethylindolo[2,1-b]quinazoline-6,12-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8,10-dimethylindolo[2,1-b]quinazoline-6,12-dione (CAS 2034136-90-6) is a chemical compound with the molecular formula C17H12N2O2 and a molecular weight of 276.29 g/mol. IUPAC name: 8,10-dimethylindolo[2,1-b]quinazoline-6,12-dione. InChIKey: NLJVDIGUWZEVCE-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O2 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 8,10-dimethylindolo[2,1-b]quinazoline-6,12-dione |
| InChIKey | NLJVDIGUWZEVCE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C3=NC4=CC=CC=C4C(=O)N23)C |
Computed by PubChem (NCBI)