CAS 1335110-53-6 is the registry number for 4-Nitro-2,5-diphenylpyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
4-nitro-2,5-diphenylpyridine (CAS 1335110-53-6) is a chemical compound with the molecular formula C17H12N2O2 and a molecular weight of 276.29 g/mol. IUPAC name: 4-nitro-2,5-diphenylpyridine. InChIKey: PTWOMANBWSZERO-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O2 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 4-nitro-2,5-diphenylpyridine |
| InChIKey | PTWOMANBWSZERO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C(=C2)[N+](=O)[O-])C3=CC=CC=C3 |
Computed by PubChem (NCBI)