CAS 315694-89-4 appears in our catalog under these names: Tc-dapk 6, 95%, TC-DAPK 6/ 98.13% (existing batch purity), TC–DAPK 6, DAPK Inhibitor, DAPK Inhibitor 1PC X 10MG. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 0,5g, 1mg, 2mg.
(4E)-2-[(E)-2-phenylethenyl]-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one (CAS 315694-89-4) is a chemical compound with the molecular formula C17H12N2O2 and a molecular weight of 276.29 g/mol. IUPAC name: (4E)-2-[(E)-2-phenylethenyl]-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one. InChIKey: GFGMISOSPOPSHN-QCTDOKRBSA-N.
| Molecular formula | C17H12N2O2 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | (4E)-2-[(E)-2-phenylethenyl]-4-(pyridin-3-ylmethylidene)-1,3-oxazol-5-one |
| InChIKey | GFGMISOSPOPSHN-QCTDOKRBSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=N/C(=C/C3=CN=CC=C3)/C(=O)O2 |
Computed by PubChem (NCBI)