CAS 1214386-48-7 is the registry number for Methyl 2,3-dichloro-6-fluorobenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 2,3-dichloro-6-fluorobenzoate (CAS 1214386-48-7) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: methyl 2,3-dichloro-6-fluorobenzoate. InChIKey: JEZURZQKLNDNFO-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | methyl 2,3-dichloro-6-fluorobenzoate |
| InChIKey | JEZURZQKLNDNFO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)Cl)F |
Computed by PubChem (NCBI)