CAS 1214697-44-5 appears in our catalog under these names: 3-Benzylpiperazin-2-one hydrochloride, 95%, 3-Benzylpiperazin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-benzylpiperazin-2-one;hydrochloride (CAS 1214697-44-5) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 3-benzylpiperazin-2-one;hydrochloride. InChIKey: CMKMIBACCJYHFI-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 3-benzylpiperazin-2-one;hydrochloride |
| InChIKey | CMKMIBACCJYHFI-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C(N1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)