CAS 1215073-56-5 appears in our catalog under these names: 5-(Pyridin-2-yl)thiazol-2-amine, 98%, 5-(Pyridin-2-yl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
5-pyridin-2-yl-1,3-thiazol-2-amine (CAS 1215073-56-5) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-pyridin-2-yl-1,3-thiazol-2-amine. InChIKey: UABSMBMZBUXKPZ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-pyridin-2-yl-1,3-thiazol-2-amine |
| InChIKey | UABSMBMZBUXKPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CN=C(S2)N |
Computed by PubChem (NCBI)