CAS 1215092-14-0 appears in our catalog under these names: (S)-α-Methyl-3-nitrophenylalanine·H2O, (S)-2-Amino-2-methyl-3-(3-nitrophenyl)propanoic acid, 95%. Offered by: Creative Peptides, Chemat Brand. Available pack sizes: 1g, 5g, on request.
(2S)-2-amino-2-methyl-3-(3-nitrophenyl)propanoic acid (CAS 1215092-14-0) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: (2S)-2-amino-2-methyl-3-(3-nitrophenyl)propanoic acid. InChIKey: RUFGGLYMLNDZAM-JTQLQIEISA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (2S)-2-amino-2-methyl-3-(3-nitrophenyl)propanoic acid |
| InChIKey | RUFGGLYMLNDZAM-JTQLQIEISA-N |
| SMILES | C[C@](CC1=CC(=CC=C1)[N+](=O)[O-])(C(=O)O)N |
Computed by PubChem (NCBI)