Products 121513-38-0
CAS 121513-38-0 appears in our catalog under these names: Phenprocoumon-d5, >95% (HPLC), Phenprocoumon-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-hydroxy-3-[1-(2,3,4,5,6-pentadeuteriophenyl)propyl]chromen-2-one (CAS 121513-38-0) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 285.3 g/mol. IUPAC name: 4-hydroxy-3-[1-(2,3,4,5,6-pentadeuteriophenyl)propyl]chromen-2-one. InChIKey: DQDAYGNAKTZFIW-YQYLVRRTSA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 4-hydroxy-3-[1-(2,3,4,5,6-pentadeuteriophenyl)propyl]chromen-2-one |
| InChIKey | DQDAYGNAKTZFIW-YQYLVRRTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CC)C2=C(C3=CC=CC=C3OC2=O)O)[2H])[2H] |
Computed by PubChem (NCBI)