Products 1215205-32-5
CAS 1215205-32-5 is the registry number for 2'-Fluoro-5'-methoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(2-fluoro-5-methoxyphenyl)benzoic acid (CAS 1215205-32-5) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-(2-fluoro-5-methoxyphenyl)benzoic acid. InChIKey: KVGKUMULNNMJJI-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-(2-fluoro-5-methoxyphenyl)benzoic acid |
| InChIKey | KVGKUMULNNMJJI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)F)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(2-fluoro-5-methoxyphenyl)benzoic acid, [1,1'-Biphenyl]-3-carboxylic acid, 2'-fluoro-5'-methoxy-, 2-Fluoro-5-methoxybiphenyl-3-carboxylic acid, 3-(2-fluoro-5-methoxy-phenyl)benzoic acid, 2''-Fluoro-5''-methoxybiphenyl-3-carboxylic Acid, 2'-Fluoro-5'-methoxy[1,1'-biphenyl]-3-carboxylic acid