Products 1215205-86-9

CAS 1215205-86-9 is the registry number for 3',5'-Dimethoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

3-(3,5-dimethoxyphenyl)benzoic acid (CAS 1215205-86-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-(3,5-dimethoxyphenyl)benzoic acid. InChIKey: VENATDFNKYVSGI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O4
Molecular weight258.27 g/mol
IUPAC name3-(3,5-dimethoxyphenyl)benzoic acid
InChIKeyVENATDFNKYVSGI-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)OC

Computed by PubChem (NCBI)