CAS 1215205-86-9 is the registry number for 3',5'-Dimethoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
3-(3,5-dimethoxyphenyl)benzoic acid (CAS 1215205-86-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-(3,5-dimethoxyphenyl)benzoic acid. InChIKey: VENATDFNKYVSGI-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-(3,5-dimethoxyphenyl)benzoic acid |
| InChIKey | VENATDFNKYVSGI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)OC |
Computed by PubChem (NCBI)