Products 1386950-93-1
CAS 1386950-93-1 is the registry number for tert-Butyl 4-(4-methoxy-3-nitrophenyl)piperazine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
Tert-butyl 4-(4-methoxy-3-nitrophenyl)piperazine-1-carboxylate (CAS 1386950-93-1) is a chemical compound with the molecular formula C16H23N3O5 and a molecular weight of 337.37 g/mol. IUPAC name: tert-butyl 4-(4-methoxy-3-nitrophenyl)piperazine-1-carboxylate. InChIKey: YQNNDDZKCKBAOK-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O5 |
|---|---|
| Molecular weight | 337.37 g/mol |
| IUPAC name | tert-butyl 4-(4-methoxy-3-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | YQNNDDZKCKBAOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=C(C=C2)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)