CAS 1215206-09-9 is the registry number for 4'-Fluoro-3'-methoxybiphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-fluoro-3-methoxyphenyl)benzoic acid (CAS 1215206-09-9) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-(4-fluoro-3-methoxyphenyl)benzoic acid. InChIKey: PTKMRNVMDXMWGA-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-(4-fluoro-3-methoxyphenyl)benzoic acid |
| InChIKey | PTKMRNVMDXMWGA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=CC=C2)C(=O)O)F |
Computed by PubChem (NCBI)