Products 1215206-35-1

CAS 1215206-35-1 is the registry number for 2'-Fluoro-3'-methoxybiphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(2-fluoro-3-methoxyphenyl)benzoic acid (CAS 1215206-35-1) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-(2-fluoro-3-methoxyphenyl)benzoic acid. InChIKey: SCTCQZIYBGGKFX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11FO3
Molecular weight246.23 g/mol
IUPAC name3-(2-fluoro-3-methoxyphenyl)benzoic acid
InChIKeySCTCQZIYBGGKFX-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1F)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)