Products 1215206-62-4

CAS 1215206-62-4 is the registry number for 4'-(Methylamino)biphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[4-(methylamino)phenyl]benzoic acid (CAS 1215206-62-4) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 3-[4-(methylamino)phenyl]benzoic acid. InChIKey: IGDSLJHRGXISFF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO2
Molecular weight227.26 g/mol
IUPAC name3-[4-(methylamino)phenyl]benzoic acid
InChIKeyIGDSLJHRGXISFF-UHFFFAOYSA-N
SMILESCNC1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)