CAS 1215206-63-5 is the registry number for 3'-(Methylamino)biphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[3-(methylamino)phenyl]benzoic acid (CAS 1215206-63-5) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 3-[3-(methylamino)phenyl]benzoic acid. InChIKey: LJUHYKRGPWUDER-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 3-[3-(methylamino)phenyl]benzoic acid |
| InChIKey | LJUHYKRGPWUDER-UHFFFAOYSA-N |
| SMILES | CNC1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)