CAS 1215213-92-5 appears in our catalog under these names: (S)-1-(4-(1-Aminoethyl)phenyl)ethanone hydrochloride, 95%, (S)-1-(4-(1-Aminoethyl)phenyl)ethanone hydrochloride, 98%, (S)–1–(4–(1–Aminoethyl)phenyl)ethanone hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
1-[4-[(1S)-1-aminoethyl]phenyl]ethanone;hydrochloride (CAS 1215213-92-5) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 1-[4-[(1S)-1-aminoethyl]phenyl]ethanone;hydrochloride. InChIKey: USBZDKPYJQEXOV-FJXQXJEOSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 1-[4-[(1S)-1-aminoethyl]phenyl]ethanone;hydrochloride |
| InChIKey | USBZDKPYJQEXOV-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(=O)C)N.Cl |
Computed by PubChem (NCBI)