CAS 1215398-95-0 appears in our catalog under these names: 2-Ethyl-2-phenylmalonamide-d5, >95% (HPLC), 2-Ethyl-2-phenylmalonamide-d5. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1mg, 5mg, 10mg, 2.5 mg.
2-(1,1,2,2,2-pentadeuterioethyl)-2-phenylpropanediamide (CAS 1215398-95-0) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 211.27 g/mol. IUPAC name: 2-(1,1,2,2,2-pentadeuterioethyl)-2-phenylpropanediamide. InChIKey: JFZHPFOXAAIUMB-ZBJDZAJPSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 211.27 g/mol |
| IUPAC name | 2-(1,1,2,2,2-pentadeuterioethyl)-2-phenylpropanediamide |
| InChIKey | JFZHPFOXAAIUMB-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(C1=CC=CC=C1)(C(=O)N)C(=O)N |
Computed by PubChem (NCBI)