CAS 1215579-44-4 is the registry number for Difluoro[3-(trifluoromethyl)pyridin-2-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2-difluoro-2-[3-(trifluoromethyl)-2-pyridinyl]acetic acid (CAS 1215579-44-4) is a chemical compound with the molecular formula C8H4F5NO2 and a molecular weight of 241.11 g/mol. IUPAC name: 2,2-difluoro-2-[3-(trifluoromethyl)-2-pyridinyl]acetic acid. InChIKey: OSXHWSBTALEFQU-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 2,2-difluoro-2-[3-(trifluoromethyl)-2-pyridinyl]acetic acid |
| InChIKey | OSXHWSBTALEFQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(C(=O)O)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)