CAS 656-84-8 is the registry number for 1-Nitro-3-(pentafluoroethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-nitro-3-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 656-84-8) is a chemical compound with the molecular formula C8H4F5NO2 and a molecular weight of 241.11 g/mol. IUPAC name: 1-nitro-3-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: PTNKXRHFXJJVLK-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 1-nitro-3-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | PTNKXRHFXJJVLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)