Products 60979-14-8
CAS 60979-14-8 is the registry number for 1-Nitro-4-(pentafluoroethyl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 60979-14-8) is a chemical compound with the molecular formula C8H4F5NO2 and a molecular weight of 241.11 g/mol. IUPAC name: 1-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: NWBQMKBXBNAKQN-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 1-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | NWBQMKBXBNAKQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)