CAS 2577172-76-8 is the registry number for 2,2-Difluoro-2-(4-(trifluoromethyl)pyridin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-2-[4-(trifluoromethyl)-2-pyridinyl]acetic acid (CAS 2577172-76-8) is a chemical compound with the molecular formula C8H4F5NO2 and a molecular weight of 241.11 g/mol. IUPAC name: 2,2-difluoro-2-[4-(trifluoromethyl)-2-pyridinyl]acetic acid. InChIKey: BTNDHQOTNMVTGC-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 2,2-difluoro-2-[4-(trifluoromethyl)-2-pyridinyl]acetic acid |
| InChIKey | BTNDHQOTNMVTGC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(F)(F)F)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)