Products 2577172-76-8

CAS 2577172-76-8 is the registry number for 2,2-Difluoro-2-(4-(trifluoromethyl)pyridin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-[4-(trifluoromethyl)-2-pyridinyl]acetic acid (CAS 2577172-76-8) is a chemical compound with the molecular formula C8H4F5NO2 and a molecular weight of 241.11 g/mol. IUPAC name: 2,2-difluoro-2-[4-(trifluoromethyl)-2-pyridinyl]acetic acid. InChIKey: BTNDHQOTNMVTGC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F5NO2
Molecular weight241.11 g/mol
IUPAC name2,2-difluoro-2-[4-(trifluoromethyl)-2-pyridinyl]acetic acid
InChIKeyBTNDHQOTNMVTGC-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1C(F)(F)F)C(C(=O)O)(F)F

Computed by PubChem (NCBI)