CAS 1215598-59-6 appears in our catalog under these names: N-Depropyl Propafenone-d5 Oxalate Salt, N-Depropyl propafenone-d5 (oxalate salt). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
1-[2-(3-amino-1,1,2,3,3-pentadeuterio-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one;oxalic acid (CAS 1215598-59-6) is a chemical compound with the molecular formula C20H23NO7 and a molecular weight of 394.4 g/mol. IUPAC name: 1-[2-(3-amino-1,1,2,3,3-pentadeuterio-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one;oxalic acid. InChIKey: UMGRCTLZIBOZHC-VWJSXAESSA-N.
| Molecular formula | C20H23NO7 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 1-[2-(3-amino-1,1,2,3,3-pentadeuterio-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one;oxalic acid |
| InChIKey | UMGRCTLZIBOZHC-VWJSXAESSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)