Products 2135713-96-9
CAS 2135713-96-9 is the registry number for Tubulin inhibitor 42. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,4R)-4-(3-hydroxy-4-methoxyphenyl)-3-(hydroxymethyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (CAS 2135713-96-9) is a chemical compound with the molecular formula C20H23NO7 and a molecular weight of 389.4 g/mol. IUPAC name: (3R,4R)-4-(3-hydroxy-4-methoxyphenyl)-3-(hydroxymethyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one. InChIKey: JJGIUCCUMYQUIO-UGSOOPFHSA-N.
| Molecular formula | C20H23NO7 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (3R,4R)-4-(3-hydroxy-4-methoxyphenyl)-3-(hydroxymethyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| InChIKey | JJGIUCCUMYQUIO-UGSOOPFHSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]2[C@@H](C(=O)N2C3=CC(=C(C(=C3)OC)OC)OC)CO)O |
Computed by PubChem (NCBI)
Synonyms:
Tubulin inhibitor 42, orb2565115