Products 3031328-45-4
CAS 3031328-45-4 is the registry number for Microtubule inhibitor 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-N-[2-hydroxy-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]acetamide (CAS 3031328-45-4) is a chemical compound with the molecular formula C20H23NO7 and a molecular weight of 389.4 g/mol. IUPAC name: 2-hydroxy-N-[2-hydroxy-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]acetamide. InChIKey: JEOLEZUCXVAHPP-UHFFFAOYSA-N.
| Molecular formula | C20H23NO7 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 2-hydroxy-N-[2-hydroxy-3-methoxy-6-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]acetamide |
| InChIKey | JEOLEZUCXVAHPP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=C)C2=CC(=C(C(=C2)OC)OC)OC)NC(=O)CO)O |
Computed by PubChem (NCBI)
Synonyms:
Microtubule inhibitor 2