Products 93885-20-2

CAS 93885-20-2 is the registry number for N-Despropyl Propafenone Oxalate Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

1-[2-(3-amino-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one;oxalic acid (CAS 93885-20-2) is a chemical compound with the molecular formula C20H23NO7 and a molecular weight of 389.4 g/mol. IUPAC name: 1-[2-(3-amino-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one;oxalic acid. InChIKey: UMGRCTLZIBOZHC-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23NO7
Molecular weight389.4 g/mol
IUPAC name1-[2-(3-amino-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one;oxalic acid
InChIKeyUMGRCTLZIBOZHC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(=O)C2=CC=CC=C2OCC(CN)O.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)