Products 1215635-13-4
CAS 1215635-13-4 appears in our catalog under these names: N-Acetyl Dapsone-d8 (Major), >95% (HPLC), N–Acetyl Dapsone–d8, N-Acetyl dapsone-d8, 99.47%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg.
N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonyl-2,3,5,6-tetradeuteriophenyl]acetamide (CAS 1215635-13-4) is a chemical compound with the molecular formula C14H14N2O3S and a molecular weight of 298.39 g/mol. IUPAC name: N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonyl-2,3,5,6-tetradeuteriophenyl]acetamide. InChIKey: WDOCBIHNYYQINH-NHNJRVLXSA-N.
| Molecular formula | C14H14N2O3S |
|---|---|
| Molecular weight | 298.39 g/mol |
| IUPAC name | N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonyl-2,3,5,6-tetradeuteriophenyl]acetamide |
| InChIKey | WDOCBIHNYYQINH-NHNJRVLXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)C2=C(C(=C(C(=C2[2H])[2H])NC(=O)C)[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
N-Acetyl Dapsone-d8 (Major), N-Acetyl Dapsone D8