CAS 2070015-08-4 appears in our catalog under these names: N-acetyl Dapsone D4, N–acetyl Dapsone–d4, N-acetyl Dapsone-d4, 98.0%, 98.0%, N-Acetyl dapsone-d4, 98.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 5 mg, 1 mg.
N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonylphenyl]acetamide (CAS 2070015-08-4) is a chemical compound with the molecular formula C14H14N2O3S and a molecular weight of 294.36 g/mol. IUPAC name: N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonylphenyl]acetamide. InChIKey: WDOCBIHNYYQINH-USSMZTJJSA-N.
| Molecular formula | C14H14N2O3S |
|---|---|
| Molecular weight | 294.36 g/mol |
| IUPAC name | N-[4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonylphenyl]acetamide |
| InChIKey | WDOCBIHNYYQINH-USSMZTJJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)C2=CC=C(C=C2)NC(=O)C)[2H] |
Computed by PubChem (NCBI)